Citric Acid
Crescent Chemical Co Inc CITRIC ACID-H2O ANALYTICAL GRD
Citric acid-H2O analytical grade Buffer Substance. Size - 1KG Storage Conditions - +15 °C TO +30 °C Catalog Number - 38640.02 CAS 5949-29-1
eMolecules 180181-02-6 | Ambeed | 3-(Boc-amino)-22-dimethylpropionic Acid | 100mg | 624122877 | A939994 | MFCD09952625 | 217.265 | C10H19NO4
Methyl 2-(3-Methylisoxazol-5-Yl)Acetate | Angene Chemical | 27349-40-2 | MFCD18833104 | 155.153 | C7H9NO3 | 97.000 | COC(=O)Cc1cc(C)no1 | 1g | 602853355
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
C(O)=O | 25mg | 714102585](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502474869.JPG-250.jpg)
eMolecules 1647201-26-0 | (R)-2-Butyloctanoic acid | ChemScene200.322 | C12H24O2 | 98.000 | CCCCCC[C@@H](CCCC)C(O)=O | 25mg | 714102585
(R)-2-Butyloctanoic acid | ChemScene | 1647201-26-0200.322 | C12H24O2 | 98.000 | CCCCCC[C@@H](CCCC)C(O)=O | 25mg | 714102585
eMolecules 626-51-7 | 3-Methylglutaric acid | Ambeed | MFCD00002727 | 146.142 | C6H10O4 | 98.000 | CC(CC(O)=O)CC(O)=O | 5g | 552757057
3-Methylglutaric acid | Ambeed | 626-51-7 | MFCD00002727 | 146.142 | C6H10O4 | 98.000 | CC(CC(O)=O)CC(O)=O | 5g | 552757057
Aqua Solutions Citric Acid/surfactant Reagent(2.9 Liters)
Citric Acid/surfactant Reagent(2.9 Liters)
=O)C(O)=O | 250mg | 600831666](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502430506.PNG-250.jpg)
eMolecules 2174-58-5 | (S)-2-Methylsuccinic acid | Ambeed | MFCD00192321 | 132.115 | C5H8O4 | 98.000 | C[C@@H](CC(O)=O)C(O)=O | 250mg | 600831666
(S)-2-Methylsuccinic acid | Ambeed | 2174-58-5 | MFCD00192321 | 132.115 | C5H8O4 | 98.000 | C[C@@H](CC(O)=O)C(O)=O | 250mg | 600831666
eMolecules 32833-96-8 | 2-(Dimethylamino)-2-oxoacetic acid | Ambeed | MFCD01971023 | 117.104 | C4H7NO3 | 97.000 | CN(C)C(=O)C(O)=O | 1g | 533498148
2-(Dimethylamino)-2-oxoacetic acid | Ambeed | 32833-96-8 | MFCD01971023 | 117.104 | C4H7NO3 | 97.000 | CN(C)C(=O)C(O)=O | 1g | 533498148
eMolecules 4152-92-5 | (2-(Aminomethyl)phenyl)methanol | ChemScene | MFCD09035091 | 137.182 | C8H11NO | 95.000 | NCc1ccccc1CO | 1g | 536845165
(2-(Aminomethyl)phenyl)methanol | ChemScene | 4152-92-5 | MFCD09035091 | 137.182 | C8H11NO | 95.000 | NCc1ccccc1CO | 1g | 536845165
eMolecules 97-61-0 | 2-Methylvaleric acid | Ambeed | MFCD00002671 | 116.160 | C6H12O2 | 97.000 | CCCC(C)C(O)=O | 25g | 552751661
2-Methylvaleric acid | Ambeed | 97-61-0 | MFCD00002671 | 116.160 | C6H12O2 | 97.000 | CCCC(C)C(O)=O | 25g | 552751661
eMolecules 475203-77-1 | Medchem Express | Mebeverine acid | 1mg | 533803116 | HY-12769 | MFCD08063738 | 279.38 | C16H25NO3
Ambeed | Methyl 2-(2-aminobenzo[d]thiazol-6-yl)acetate | 100mg | 600845970 | A701819 | 99738-99-5 | MFCD18643368 | 222.260 | C10H10N2O2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 87392-05-0 | Ambeed | (R)-2-Tetrahydrofuroic acid | 10g | 490497500 | A117217 | MFCD00211271 | 116.116 | C5H8O3
Ambeed | (R)-2-Tetrahydrofuroic acid | 10g | 490497500 | A117217 | 87392-05-0 | MFCD00211271 | 116.116 | C5H8O3
eMolecules 1287670-30-7 | 2-(2-((tert-butoxycarbonyl)(2,2,2-trifluoroethyl)amino)pyridin-4-yl)oxazole-4-carboxylic acid | Synthonix387.315 | C16H16F3N3O5 | 98.000 | CC(C)(C)OC(=O)N(CC(F)(F)F)c1cc(ccn1)-c1nc(co1)C(O)=O | 250mg | 794075712
2-(2-((tert-butoxycarbonyl)(2,2,2-trifluoroethyl)amino)pyridin-4-yl)oxazole-4-carboxylic acid | Synthonix | 1287670-30-7387.315 | C16H16F3N3O5 | 98.000 | CC(C)(C)OC(=O)N(CC(F)(F)F)c1cc(ccn1)-c1nc(co1)C(O)=O | 250mg | 794075712
eMolecules 92549-67-2 | 2,2-bis(4-hydroxyphenyl)propanoic acid | Synthonix258.273 | C15H14O4 | 95.000 | CC(C(O)=O)(c1ccc(O)cc1)c1ccc(O)cc1 | 100mg | 784553663
2,2-bis(4-hydroxyphenyl)propanoic acid | Synthonix | 92549-67-2258.273 | C15H14O4 | 95.000 | CC(C(O)=O)(c1ccc(O)cc1)c1ccc(O)cc1 | 100mg | 784553663
![eMolecules 2248271-56-7 | 4-{[(tert-butoxy)carbonyl]amino}-2-chloro-6-fluorobenzoic acid | Synthonix289.690 | C12H13ClFNO4 | 98.000 | CC(C)(C)OC(=O)Nc1cc(F)c(C(O)=O)c(Cl)c1 | 10mg | 794075932](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477998.JPG-250.jpg)
eMolecules 2248271-56-7 | 4-{[(tert-butoxy)carbonyl]amino}-2-chloro-6-fluorobenzoic acid | Synthonix289.690 | C12H13ClFNO4 | 98.000 | CC(C)(C)OC(=O)Nc1cc(F)c(C(O)=O)c(Cl)c1 | 10mg | 794075932
4-{[(tert-butoxy)carbonyl]amino}-2-chloro-6-fluorobenzoic acid | Synthonix | 2248271-56-7289.690 | C12H13ClFNO4 | 98.000 | CC(C)(C)OC(=O)Nc1cc(F)c(C(O)=O)c(Cl)c1 | 10mg | 794075932
eMolecules 1369798-11-7 | 3-isopropoxy-2-methylbenzoic acid | Synthonix | MFCD24311738 | 194.230 | C11H14O3 | 98.000 | CC(C)Oc1cccc(C(O)=O)c1C | 100mg | 794075791
3-isopropoxy-2-methylbenzoic acid | Synthonix | 1369798-11-7 | MFCD24311738 | 194.230 | C11H14O3 | 98.000 | CC(C)Oc1cccc(C(O)=O)c1C | 100mg | 794075791